
The addSplitRefRecursiveFunctions LazyCallGraph helper should not require a reference between every new function. Spurious ref edges between the new functions are allowed and the new function are considered to be a RefSCC. This change clarifies that this is the case in the method's description and its DEBUG mode verifier.
2075 lines
75 KiB
C++
2075 lines
75 KiB
C++
//===- LazyCallGraph.cpp - Analysis of a Module's call graph --------------===//
|
|
//
|
|
// Part of the LLVM Project, under the Apache License v2.0 with LLVM Exceptions.
|
|
// See https://llvm.org/LICENSE.txt for license information.
|
|
// SPDX-License-Identifier: Apache-2.0 WITH LLVM-exception
|
|
//
|
|
//===----------------------------------------------------------------------===//
|
|
|
|
#include "llvm/Analysis/LazyCallGraph.h"
|
|
|
|
#include "llvm/ADT/ArrayRef.h"
|
|
#include "llvm/ADT/STLExtras.h"
|
|
#include "llvm/ADT/Sequence.h"
|
|
#include "llvm/ADT/SmallPtrSet.h"
|
|
#include "llvm/ADT/SmallVector.h"
|
|
#include "llvm/ADT/iterator_range.h"
|
|
#include "llvm/Analysis/TargetLibraryInfo.h"
|
|
#include "llvm/IR/Constants.h"
|
|
#include "llvm/IR/Function.h"
|
|
#include "llvm/IR/GlobalVariable.h"
|
|
#include "llvm/IR/InstIterator.h"
|
|
#include "llvm/IR/Instruction.h"
|
|
#include "llvm/IR/Module.h"
|
|
#include "llvm/IR/PassManager.h"
|
|
#include "llvm/Support/Casting.h"
|
|
#include "llvm/Support/Compiler.h"
|
|
#include "llvm/Support/Debug.h"
|
|
#include "llvm/Support/GraphWriter.h"
|
|
#include "llvm/Support/raw_ostream.h"
|
|
#include <algorithm>
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
#include "llvm/ADT/ScopeExit.h"
|
|
#endif
|
|
|
|
using namespace llvm;
|
|
|
|
#define DEBUG_TYPE "lcg"
|
|
|
|
template struct LLVM_EXPORT_TEMPLATE Any::TypeId<const LazyCallGraph::SCC *>;
|
|
|
|
void LazyCallGraph::EdgeSequence::insertEdgeInternal(Node &TargetN,
|
|
Edge::Kind EK) {
|
|
EdgeIndexMap.try_emplace(&TargetN, Edges.size());
|
|
Edges.emplace_back(TargetN, EK);
|
|
}
|
|
|
|
void LazyCallGraph::EdgeSequence::setEdgeKind(Node &TargetN, Edge::Kind EK) {
|
|
Edges[EdgeIndexMap.find(&TargetN)->second].setKind(EK);
|
|
}
|
|
|
|
bool LazyCallGraph::EdgeSequence::removeEdgeInternal(Node &TargetN) {
|
|
auto IndexMapI = EdgeIndexMap.find(&TargetN);
|
|
if (IndexMapI == EdgeIndexMap.end())
|
|
return false;
|
|
|
|
Edges[IndexMapI->second] = Edge();
|
|
EdgeIndexMap.erase(IndexMapI);
|
|
return true;
|
|
}
|
|
|
|
static void addEdge(SmallVectorImpl<LazyCallGraph::Edge> &Edges,
|
|
DenseMap<LazyCallGraph::Node *, int> &EdgeIndexMap,
|
|
LazyCallGraph::Node &N, LazyCallGraph::Edge::Kind EK) {
|
|
if (!EdgeIndexMap.try_emplace(&N, Edges.size()).second)
|
|
return;
|
|
|
|
LLVM_DEBUG(dbgs() << " Added callable function: " << N.getName() << "\n");
|
|
Edges.emplace_back(LazyCallGraph::Edge(N, EK));
|
|
}
|
|
|
|
LazyCallGraph::EdgeSequence &LazyCallGraph::Node::populateSlow() {
|
|
assert(!Edges && "Must not have already populated the edges for this node!");
|
|
|
|
LLVM_DEBUG(dbgs() << " Adding functions called by '" << getName()
|
|
<< "' to the graph.\n");
|
|
|
|
Edges = EdgeSequence();
|
|
|
|
SmallVector<Constant *, 16> Worklist;
|
|
SmallPtrSet<Function *, 4> Callees;
|
|
SmallPtrSet<Constant *, 16> Visited;
|
|
|
|
// Find all the potential call graph edges in this function. We track both
|
|
// actual call edges and indirect references to functions. The direct calls
|
|
// are trivially added, but to accumulate the latter we walk the instructions
|
|
// and add every operand which is a constant to the worklist to process
|
|
// afterward.
|
|
//
|
|
// Note that we consider *any* function with a definition to be a viable
|
|
// edge. Even if the function's definition is subject to replacement by
|
|
// some other module (say, a weak definition) there may still be
|
|
// optimizations which essentially speculate based on the definition and
|
|
// a way to check that the specific definition is in fact the one being
|
|
// used. For example, this could be done by moving the weak definition to
|
|
// a strong (internal) definition and making the weak definition be an
|
|
// alias. Then a test of the address of the weak function against the new
|
|
// strong definition's address would be an effective way to determine the
|
|
// safety of optimizing a direct call edge.
|
|
for (BasicBlock &BB : *F)
|
|
for (Instruction &I : BB) {
|
|
if (auto *CB = dyn_cast<CallBase>(&I))
|
|
if (Function *Callee = CB->getCalledFunction())
|
|
if (!Callee->isDeclaration())
|
|
if (Callees.insert(Callee).second) {
|
|
Visited.insert(Callee);
|
|
addEdge(Edges->Edges, Edges->EdgeIndexMap, G->get(*Callee),
|
|
LazyCallGraph::Edge::Call);
|
|
}
|
|
|
|
for (Value *Op : I.operand_values())
|
|
if (Constant *C = dyn_cast<Constant>(Op))
|
|
if (Visited.insert(C).second)
|
|
Worklist.push_back(C);
|
|
}
|
|
|
|
// We've collected all the constant (and thus potentially function or
|
|
// function containing) operands to all the instructions in the function.
|
|
// Process them (recursively) collecting every function found.
|
|
visitReferences(Worklist, Visited, [&](Function &F) {
|
|
addEdge(Edges->Edges, Edges->EdgeIndexMap, G->get(F),
|
|
LazyCallGraph::Edge::Ref);
|
|
});
|
|
|
|
// Add implicit reference edges to any defined libcall functions (if we
|
|
// haven't found an explicit edge).
|
|
for (auto *F : G->LibFunctions)
|
|
if (!Visited.count(F))
|
|
addEdge(Edges->Edges, Edges->EdgeIndexMap, G->get(*F),
|
|
LazyCallGraph::Edge::Ref);
|
|
|
|
return *Edges;
|
|
}
|
|
|
|
void LazyCallGraph::Node::replaceFunction(Function &NewF) {
|
|
assert(F != &NewF && "Must not replace a function with itself!");
|
|
F = &NewF;
|
|
}
|
|
|
|
#if !defined(NDEBUG) || defined(LLVM_ENABLE_DUMP)
|
|
LLVM_DUMP_METHOD void LazyCallGraph::Node::dump() const {
|
|
dbgs() << *this << '\n';
|
|
}
|
|
#endif
|
|
|
|
static bool isKnownLibFunction(Function &F, TargetLibraryInfo &TLI) {
|
|
LibFunc LF;
|
|
|
|
// Either this is a normal library function or a "vectorizable"
|
|
// function. Not using the VFDatabase here because this query
|
|
// is related only to libraries handled via the TLI.
|
|
return TLI.getLibFunc(F, LF) ||
|
|
TLI.isKnownVectorFunctionInLibrary(F.getName());
|
|
}
|
|
|
|
LazyCallGraph::LazyCallGraph(
|
|
Module &M, function_ref<TargetLibraryInfo &(Function &)> GetTLI) {
|
|
LLVM_DEBUG(dbgs() << "Building CG for module: " << M.getModuleIdentifier()
|
|
<< "\n");
|
|
for (Function &F : M) {
|
|
if (F.isDeclaration())
|
|
continue;
|
|
// If this function is a known lib function to LLVM then we want to
|
|
// synthesize reference edges to it to model the fact that LLVM can turn
|
|
// arbitrary code into a library function call.
|
|
if (isKnownLibFunction(F, GetTLI(F)))
|
|
LibFunctions.insert(&F);
|
|
|
|
if (F.hasLocalLinkage())
|
|
continue;
|
|
|
|
// External linkage defined functions have edges to them from other
|
|
// modules.
|
|
LLVM_DEBUG(dbgs() << " Adding '" << F.getName()
|
|
<< "' to entry set of the graph.\n");
|
|
addEdge(EntryEdges.Edges, EntryEdges.EdgeIndexMap, get(F), Edge::Ref);
|
|
}
|
|
|
|
// Externally visible aliases of internal functions are also viable entry
|
|
// edges to the module.
|
|
for (auto &A : M.aliases()) {
|
|
if (A.hasLocalLinkage())
|
|
continue;
|
|
if (Function* F = dyn_cast<Function>(A.getAliasee())) {
|
|
LLVM_DEBUG(dbgs() << " Adding '" << F->getName()
|
|
<< "' with alias '" << A.getName()
|
|
<< "' to entry set of the graph.\n");
|
|
addEdge(EntryEdges.Edges, EntryEdges.EdgeIndexMap, get(*F), Edge::Ref);
|
|
}
|
|
}
|
|
|
|
// Now add entry nodes for functions reachable via initializers to globals.
|
|
SmallVector<Constant *, 16> Worklist;
|
|
SmallPtrSet<Constant *, 16> Visited;
|
|
for (GlobalVariable &GV : M.globals())
|
|
if (GV.hasInitializer())
|
|
if (Visited.insert(GV.getInitializer()).second)
|
|
Worklist.push_back(GV.getInitializer());
|
|
|
|
LLVM_DEBUG(
|
|
dbgs() << " Adding functions referenced by global initializers to the "
|
|
"entry set.\n");
|
|
visitReferences(Worklist, Visited, [&](Function &F) {
|
|
addEdge(EntryEdges.Edges, EntryEdges.EdgeIndexMap, get(F),
|
|
LazyCallGraph::Edge::Ref);
|
|
});
|
|
}
|
|
|
|
LazyCallGraph::LazyCallGraph(LazyCallGraph &&G)
|
|
: BPA(std::move(G.BPA)), NodeMap(std::move(G.NodeMap)),
|
|
EntryEdges(std::move(G.EntryEdges)), SCCBPA(std::move(G.SCCBPA)),
|
|
SCCMap(std::move(G.SCCMap)), LibFunctions(std::move(G.LibFunctions)) {
|
|
updateGraphPtrs();
|
|
}
|
|
|
|
#if !defined(NDEBUG) || defined(EXPENSIVE_CHECKS)
|
|
void LazyCallGraph::verify() {
|
|
for (RefSCC &RC : postorder_ref_sccs()) {
|
|
RC.verify();
|
|
}
|
|
}
|
|
#endif
|
|
|
|
bool LazyCallGraph::invalidate(Module &, const PreservedAnalyses &PA,
|
|
ModuleAnalysisManager::Invalidator &) {
|
|
// Check whether the analysis, all analyses on functions, or the function's
|
|
// CFG have been preserved.
|
|
auto PAC = PA.getChecker<llvm::LazyCallGraphAnalysis>();
|
|
return !(PAC.preserved() || PAC.preservedSet<AllAnalysesOn<Module>>());
|
|
}
|
|
|
|
LazyCallGraph &LazyCallGraph::operator=(LazyCallGraph &&G) {
|
|
BPA = std::move(G.BPA);
|
|
NodeMap = std::move(G.NodeMap);
|
|
EntryEdges = std::move(G.EntryEdges);
|
|
SCCBPA = std::move(G.SCCBPA);
|
|
SCCMap = std::move(G.SCCMap);
|
|
LibFunctions = std::move(G.LibFunctions);
|
|
updateGraphPtrs();
|
|
return *this;
|
|
}
|
|
|
|
#if !defined(NDEBUG) || defined(LLVM_ENABLE_DUMP)
|
|
LLVM_DUMP_METHOD void LazyCallGraph::SCC::dump() const {
|
|
dbgs() << *this << '\n';
|
|
}
|
|
#endif
|
|
|
|
#if !defined(NDEBUG) || defined(EXPENSIVE_CHECKS)
|
|
void LazyCallGraph::SCC::verify() {
|
|
assert(OuterRefSCC && "Can't have a null RefSCC!");
|
|
assert(!Nodes.empty() && "Can't have an empty SCC!");
|
|
|
|
for (Node *N : Nodes) {
|
|
assert(N && "Can't have a null node!");
|
|
assert(OuterRefSCC->G->lookupSCC(*N) == this &&
|
|
"Node does not map to this SCC!");
|
|
assert(N->DFSNumber == -1 &&
|
|
"Must set DFS numbers to -1 when adding a node to an SCC!");
|
|
assert(N->LowLink == -1 &&
|
|
"Must set low link to -1 when adding a node to an SCC!");
|
|
for (Edge &E : **N)
|
|
assert(E.getNode().isPopulated() && "Can't have an unpopulated node!");
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Verify that all nodes in this SCC can reach all other nodes.
|
|
SmallVector<Node *, 4> Worklist;
|
|
SmallPtrSet<Node *, 4> Visited;
|
|
Worklist.push_back(N);
|
|
while (!Worklist.empty()) {
|
|
Node *VisitingNode = Worklist.pop_back_val();
|
|
if (!Visited.insert(VisitingNode).second)
|
|
continue;
|
|
for (Edge &E : (*VisitingNode)->calls())
|
|
Worklist.push_back(&E.getNode());
|
|
}
|
|
for (Node *NodeToVisit : Nodes) {
|
|
assert(Visited.contains(NodeToVisit) &&
|
|
"Cannot reach all nodes within SCC");
|
|
}
|
|
#endif
|
|
}
|
|
}
|
|
#endif
|
|
|
|
bool LazyCallGraph::SCC::isParentOf(const SCC &C) const {
|
|
if (this == &C)
|
|
return false;
|
|
|
|
for (Node &N : *this)
|
|
for (Edge &E : N->calls())
|
|
if (OuterRefSCC->G->lookupSCC(E.getNode()) == &C)
|
|
return true;
|
|
|
|
// No edges found.
|
|
return false;
|
|
}
|
|
|
|
bool LazyCallGraph::SCC::isAncestorOf(const SCC &TargetC) const {
|
|
if (this == &TargetC)
|
|
return false;
|
|
|
|
LazyCallGraph &G = *OuterRefSCC->G;
|
|
|
|
// Start with this SCC.
|
|
SmallPtrSet<const SCC *, 16> Visited = {this};
|
|
SmallVector<const SCC *, 16> Worklist = {this};
|
|
|
|
// Walk down the graph until we run out of edges or find a path to TargetC.
|
|
do {
|
|
const SCC &C = *Worklist.pop_back_val();
|
|
for (Node &N : C)
|
|
for (Edge &E : N->calls()) {
|
|
SCC *CalleeC = G.lookupSCC(E.getNode());
|
|
if (!CalleeC)
|
|
continue;
|
|
|
|
// If the callee's SCC is the TargetC, we're done.
|
|
if (CalleeC == &TargetC)
|
|
return true;
|
|
|
|
// If this is the first time we've reached this SCC, put it on the
|
|
// worklist to recurse through.
|
|
if (Visited.insert(CalleeC).second)
|
|
Worklist.push_back(CalleeC);
|
|
}
|
|
} while (!Worklist.empty());
|
|
|
|
// No paths found.
|
|
return false;
|
|
}
|
|
|
|
LazyCallGraph::RefSCC::RefSCC(LazyCallGraph &G) : G(&G) {}
|
|
|
|
#if !defined(NDEBUG) || defined(LLVM_ENABLE_DUMP)
|
|
LLVM_DUMP_METHOD void LazyCallGraph::RefSCC::dump() const {
|
|
dbgs() << *this << '\n';
|
|
}
|
|
#endif
|
|
|
|
#if !defined(NDEBUG) || defined(EXPENSIVE_CHECKS)
|
|
void LazyCallGraph::RefSCC::verify() {
|
|
assert(G && "Can't have a null graph!");
|
|
assert(!SCCs.empty() && "Can't have an empty SCC!");
|
|
|
|
// Verify basic properties of the SCCs.
|
|
SmallPtrSet<SCC *, 4> SCCSet;
|
|
for (SCC *C : SCCs) {
|
|
assert(C && "Can't have a null SCC!");
|
|
C->verify();
|
|
assert(&C->getOuterRefSCC() == this &&
|
|
"SCC doesn't think it is inside this RefSCC!");
|
|
bool Inserted = SCCSet.insert(C).second;
|
|
assert(Inserted && "Found a duplicate SCC!");
|
|
auto IndexIt = SCCIndices.find(C);
|
|
assert(IndexIt != SCCIndices.end() &&
|
|
"Found an SCC that doesn't have an index!");
|
|
}
|
|
|
|
// Check that our indices map correctly.
|
|
for (auto [C, I] : SCCIndices) {
|
|
assert(C && "Can't have a null SCC in the indices!");
|
|
assert(SCCSet.count(C) && "Found an index for an SCC not in the RefSCC!");
|
|
assert(SCCs[I] == C && "Index doesn't point to SCC!");
|
|
}
|
|
|
|
// Check that the SCCs are in fact in post-order.
|
|
for (int I = 0, Size = SCCs.size(); I < Size; ++I) {
|
|
SCC &SourceSCC = *SCCs[I];
|
|
for (Node &N : SourceSCC)
|
|
for (Edge &E : *N) {
|
|
if (!E.isCall())
|
|
continue;
|
|
SCC &TargetSCC = *G->lookupSCC(E.getNode());
|
|
if (&TargetSCC.getOuterRefSCC() == this) {
|
|
assert(SCCIndices.find(&TargetSCC)->second <= I &&
|
|
"Edge between SCCs violates post-order relationship.");
|
|
continue;
|
|
}
|
|
}
|
|
}
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Verify that all nodes in this RefSCC can reach all other nodes.
|
|
SmallVector<Node *> Nodes;
|
|
for (SCC *C : SCCs) {
|
|
for (Node &N : *C)
|
|
Nodes.push_back(&N);
|
|
}
|
|
for (Node *N : Nodes) {
|
|
SmallVector<Node *, 4> Worklist;
|
|
SmallPtrSet<Node *, 4> Visited;
|
|
Worklist.push_back(N);
|
|
while (!Worklist.empty()) {
|
|
Node *VisitingNode = Worklist.pop_back_val();
|
|
if (!Visited.insert(VisitingNode).second)
|
|
continue;
|
|
for (Edge &E : **VisitingNode)
|
|
Worklist.push_back(&E.getNode());
|
|
}
|
|
for (Node *NodeToVisit : Nodes) {
|
|
assert(Visited.contains(NodeToVisit) &&
|
|
"Cannot reach all nodes within RefSCC");
|
|
}
|
|
}
|
|
#endif
|
|
}
|
|
#endif
|
|
|
|
bool LazyCallGraph::RefSCC::isParentOf(const RefSCC &RC) const {
|
|
if (&RC == this)
|
|
return false;
|
|
|
|
// Search all edges to see if this is a parent.
|
|
for (SCC &C : *this)
|
|
for (Node &N : C)
|
|
for (Edge &E : *N)
|
|
if (G->lookupRefSCC(E.getNode()) == &RC)
|
|
return true;
|
|
|
|
return false;
|
|
}
|
|
|
|
bool LazyCallGraph::RefSCC::isAncestorOf(const RefSCC &RC) const {
|
|
if (&RC == this)
|
|
return false;
|
|
|
|
// For each descendant of this RefSCC, see if one of its children is the
|
|
// argument. If not, add that descendant to the worklist and continue
|
|
// searching.
|
|
SmallVector<const RefSCC *, 4> Worklist;
|
|
SmallPtrSet<const RefSCC *, 4> Visited;
|
|
Worklist.push_back(this);
|
|
Visited.insert(this);
|
|
do {
|
|
const RefSCC &DescendantRC = *Worklist.pop_back_val();
|
|
for (SCC &C : DescendantRC)
|
|
for (Node &N : C)
|
|
for (Edge &E : *N) {
|
|
auto *ChildRC = G->lookupRefSCC(E.getNode());
|
|
if (ChildRC == &RC)
|
|
return true;
|
|
if (!ChildRC || !Visited.insert(ChildRC).second)
|
|
continue;
|
|
Worklist.push_back(ChildRC);
|
|
}
|
|
} while (!Worklist.empty());
|
|
|
|
return false;
|
|
}
|
|
|
|
/// Generic helper that updates a postorder sequence of SCCs for a potentially
|
|
/// cycle-introducing edge insertion.
|
|
///
|
|
/// A postorder sequence of SCCs of a directed graph has one fundamental
|
|
/// property: all deges in the DAG of SCCs point "up" the sequence. That is,
|
|
/// all edges in the SCC DAG point to prior SCCs in the sequence.
|
|
///
|
|
/// This routine both updates a postorder sequence and uses that sequence to
|
|
/// compute the set of SCCs connected into a cycle. It should only be called to
|
|
/// insert a "downward" edge which will require changing the sequence to
|
|
/// restore it to a postorder.
|
|
///
|
|
/// When inserting an edge from an earlier SCC to a later SCC in some postorder
|
|
/// sequence, all of the SCCs which may be impacted are in the closed range of
|
|
/// those two within the postorder sequence. The algorithm used here to restore
|
|
/// the state is as follows:
|
|
///
|
|
/// 1) Starting from the source SCC, construct a set of SCCs which reach the
|
|
/// source SCC consisting of just the source SCC. Then scan toward the
|
|
/// target SCC in postorder and for each SCC, if it has an edge to an SCC
|
|
/// in the set, add it to the set. Otherwise, the source SCC is not
|
|
/// a successor, move it in the postorder sequence to immediately before
|
|
/// the source SCC, shifting the source SCC and all SCCs in the set one
|
|
/// position toward the target SCC. Stop scanning after processing the
|
|
/// target SCC.
|
|
/// 2) If the source SCC is now past the target SCC in the postorder sequence,
|
|
/// and thus the new edge will flow toward the start, we are done.
|
|
/// 3) Otherwise, starting from the target SCC, walk all edges which reach an
|
|
/// SCC between the source and the target, and add them to the set of
|
|
/// connected SCCs, then recurse through them. Once a complete set of the
|
|
/// SCCs the target connects to is known, hoist the remaining SCCs between
|
|
/// the source and the target to be above the target. Note that there is no
|
|
/// need to process the source SCC, it is already known to connect.
|
|
/// 4) At this point, all of the SCCs in the closed range between the source
|
|
/// SCC and the target SCC in the postorder sequence are connected,
|
|
/// including the target SCC and the source SCC. Inserting the edge from
|
|
/// the source SCC to the target SCC will form a cycle out of precisely
|
|
/// these SCCs. Thus we can merge all of the SCCs in this closed range into
|
|
/// a single SCC.
|
|
///
|
|
/// This process has various important properties:
|
|
/// - Only mutates the SCCs when adding the edge actually changes the SCC
|
|
/// structure.
|
|
/// - Never mutates SCCs which are unaffected by the change.
|
|
/// - Updates the postorder sequence to correctly satisfy the postorder
|
|
/// constraint after the edge is inserted.
|
|
/// - Only reorders SCCs in the closed postorder sequence from the source to
|
|
/// the target, so easy to bound how much has changed even in the ordering.
|
|
/// - Big-O is the number of edges in the closed postorder range of SCCs from
|
|
/// source to target.
|
|
///
|
|
/// This helper routine, in addition to updating the postorder sequence itself
|
|
/// will also update a map from SCCs to indices within that sequence.
|
|
///
|
|
/// The sequence and the map must operate on pointers to the SCC type.
|
|
///
|
|
/// Two callbacks must be provided. The first computes the subset of SCCs in
|
|
/// the postorder closed range from the source to the target which connect to
|
|
/// the source SCC via some (transitive) set of edges. The second computes the
|
|
/// subset of the same range which the target SCC connects to via some
|
|
/// (transitive) set of edges. Both callbacks should populate the set argument
|
|
/// provided.
|
|
template <typename SCCT, typename PostorderSequenceT, typename SCCIndexMapT,
|
|
typename ComputeSourceConnectedSetCallableT,
|
|
typename ComputeTargetConnectedSetCallableT>
|
|
static iterator_range<typename PostorderSequenceT::iterator>
|
|
updatePostorderSequenceForEdgeInsertion(
|
|
SCCT &SourceSCC, SCCT &TargetSCC, PostorderSequenceT &SCCs,
|
|
SCCIndexMapT &SCCIndices,
|
|
ComputeSourceConnectedSetCallableT ComputeSourceConnectedSet,
|
|
ComputeTargetConnectedSetCallableT ComputeTargetConnectedSet) {
|
|
int SourceIdx = SCCIndices[&SourceSCC];
|
|
int TargetIdx = SCCIndices[&TargetSCC];
|
|
assert(SourceIdx < TargetIdx && "Cannot have equal indices here!");
|
|
|
|
SmallPtrSet<SCCT *, 4> ConnectedSet;
|
|
|
|
// Compute the SCCs which (transitively) reach the source.
|
|
ComputeSourceConnectedSet(ConnectedSet);
|
|
|
|
// Partition the SCCs in this part of the port-order sequence so only SCCs
|
|
// connecting to the source remain between it and the target. This is
|
|
// a benign partition as it preserves postorder.
|
|
auto SourceI = std::stable_partition(
|
|
SCCs.begin() + SourceIdx, SCCs.begin() + TargetIdx + 1,
|
|
[&ConnectedSet](SCCT *C) { return !ConnectedSet.count(C); });
|
|
for (int I = SourceIdx, E = TargetIdx + 1; I < E; ++I)
|
|
SCCIndices.find(SCCs[I])->second = I;
|
|
|
|
// If the target doesn't connect to the source, then we've corrected the
|
|
// post-order and there are no cycles formed.
|
|
if (!ConnectedSet.count(&TargetSCC)) {
|
|
assert(SourceI > (SCCs.begin() + SourceIdx) &&
|
|
"Must have moved the source to fix the post-order.");
|
|
assert(*std::prev(SourceI) == &TargetSCC &&
|
|
"Last SCC to move should have bene the target.");
|
|
|
|
// Return an empty range at the target SCC indicating there is nothing to
|
|
// merge.
|
|
return make_range(std::prev(SourceI), std::prev(SourceI));
|
|
}
|
|
|
|
assert(SCCs[TargetIdx] == &TargetSCC &&
|
|
"Should not have moved target if connected!");
|
|
SourceIdx = SourceI - SCCs.begin();
|
|
assert(SCCs[SourceIdx] == &SourceSCC &&
|
|
"Bad updated index computation for the source SCC!");
|
|
|
|
// See whether there are any remaining intervening SCCs between the source
|
|
// and target. If so we need to make sure they all are reachable form the
|
|
// target.
|
|
if (SourceIdx + 1 < TargetIdx) {
|
|
ConnectedSet.clear();
|
|
ComputeTargetConnectedSet(ConnectedSet);
|
|
|
|
// Partition SCCs so that only SCCs reached from the target remain between
|
|
// the source and the target. This preserves postorder.
|
|
auto TargetI = std::stable_partition(
|
|
SCCs.begin() + SourceIdx + 1, SCCs.begin() + TargetIdx + 1,
|
|
[&ConnectedSet](SCCT *C) { return ConnectedSet.count(C); });
|
|
for (int I = SourceIdx + 1, E = TargetIdx + 1; I < E; ++I)
|
|
SCCIndices.find(SCCs[I])->second = I;
|
|
TargetIdx = std::prev(TargetI) - SCCs.begin();
|
|
assert(SCCs[TargetIdx] == &TargetSCC &&
|
|
"Should always end with the target!");
|
|
}
|
|
|
|
// At this point, we know that connecting source to target forms a cycle
|
|
// because target connects back to source, and we know that all the SCCs
|
|
// between the source and target in the postorder sequence participate in that
|
|
// cycle.
|
|
return make_range(SCCs.begin() + SourceIdx, SCCs.begin() + TargetIdx);
|
|
}
|
|
|
|
bool LazyCallGraph::RefSCC::switchInternalEdgeToCall(
|
|
Node &SourceN, Node &TargetN,
|
|
function_ref<void(ArrayRef<SCC *> MergeSCCs)> MergeCB) {
|
|
assert(!(*SourceN)[TargetN].isCall() && "Must start with a ref edge!");
|
|
SmallVector<SCC *, 1> DeletedSCCs;
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() { verify(); });
|
|
#endif
|
|
|
|
SCC &SourceSCC = *G->lookupSCC(SourceN);
|
|
SCC &TargetSCC = *G->lookupSCC(TargetN);
|
|
|
|
// If the two nodes are already part of the same SCC, we're also done as
|
|
// we've just added more connectivity.
|
|
if (&SourceSCC == &TargetSCC) {
|
|
SourceN->setEdgeKind(TargetN, Edge::Call);
|
|
return false; // No new cycle.
|
|
}
|
|
|
|
// At this point we leverage the postorder list of SCCs to detect when the
|
|
// insertion of an edge changes the SCC structure in any way.
|
|
//
|
|
// First and foremost, we can eliminate the need for any changes when the
|
|
// edge is toward the beginning of the postorder sequence because all edges
|
|
// flow in that direction already. Thus adding a new one cannot form a cycle.
|
|
int SourceIdx = SCCIndices[&SourceSCC];
|
|
int TargetIdx = SCCIndices[&TargetSCC];
|
|
if (TargetIdx < SourceIdx) {
|
|
SourceN->setEdgeKind(TargetN, Edge::Call);
|
|
return false; // No new cycle.
|
|
}
|
|
|
|
// Compute the SCCs which (transitively) reach the source.
|
|
auto ComputeSourceConnectedSet = [&](SmallPtrSetImpl<SCC *> &ConnectedSet) {
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Check that the RefSCC is still valid before computing this as the
|
|
// results will be nonsensical of we've broken its invariants.
|
|
verify();
|
|
#endif
|
|
ConnectedSet.insert(&SourceSCC);
|
|
auto IsConnected = [&](SCC &C) {
|
|
for (Node &N : C)
|
|
for (Edge &E : N->calls())
|
|
if (ConnectedSet.count(G->lookupSCC(E.getNode())))
|
|
return true;
|
|
|
|
return false;
|
|
};
|
|
|
|
for (SCC *C :
|
|
make_range(SCCs.begin() + SourceIdx + 1, SCCs.begin() + TargetIdx + 1))
|
|
if (IsConnected(*C))
|
|
ConnectedSet.insert(C);
|
|
};
|
|
|
|
// Use a normal worklist to find which SCCs the target connects to. We still
|
|
// bound the search based on the range in the postorder list we care about,
|
|
// but because this is forward connectivity we just "recurse" through the
|
|
// edges.
|
|
auto ComputeTargetConnectedSet = [&](SmallPtrSetImpl<SCC *> &ConnectedSet) {
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Check that the RefSCC is still valid before computing this as the
|
|
// results will be nonsensical of we've broken its invariants.
|
|
verify();
|
|
#endif
|
|
ConnectedSet.insert(&TargetSCC);
|
|
SmallVector<SCC *, 4> Worklist;
|
|
Worklist.push_back(&TargetSCC);
|
|
do {
|
|
SCC &C = *Worklist.pop_back_val();
|
|
for (Node &N : C)
|
|
for (Edge &E : *N) {
|
|
if (!E.isCall())
|
|
continue;
|
|
SCC &EdgeC = *G->lookupSCC(E.getNode());
|
|
if (&EdgeC.getOuterRefSCC() != this)
|
|
// Not in this RefSCC...
|
|
continue;
|
|
if (SCCIndices.find(&EdgeC)->second <= SourceIdx)
|
|
// Not in the postorder sequence between source and target.
|
|
continue;
|
|
|
|
if (ConnectedSet.insert(&EdgeC).second)
|
|
Worklist.push_back(&EdgeC);
|
|
}
|
|
} while (!Worklist.empty());
|
|
};
|
|
|
|
// Use a generic helper to update the postorder sequence of SCCs and return
|
|
// a range of any SCCs connected into a cycle by inserting this edge. This
|
|
// routine will also take care of updating the indices into the postorder
|
|
// sequence.
|
|
auto MergeRange = updatePostorderSequenceForEdgeInsertion(
|
|
SourceSCC, TargetSCC, SCCs, SCCIndices, ComputeSourceConnectedSet,
|
|
ComputeTargetConnectedSet);
|
|
|
|
// Run the user's callback on the merged SCCs before we actually merge them.
|
|
if (MergeCB)
|
|
MergeCB(ArrayRef(MergeRange.begin(), MergeRange.end()));
|
|
|
|
// If the merge range is empty, then adding the edge didn't actually form any
|
|
// new cycles. We're done.
|
|
if (MergeRange.empty()) {
|
|
// Now that the SCC structure is finalized, flip the kind to call.
|
|
SourceN->setEdgeKind(TargetN, Edge::Call);
|
|
return false; // No new cycle.
|
|
}
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Before merging, check that the RefSCC remains valid after all the
|
|
// postorder updates.
|
|
verify();
|
|
#endif
|
|
|
|
// Otherwise we need to merge all the SCCs in the cycle into a single result
|
|
// SCC.
|
|
//
|
|
// NB: We merge into the target because all of these functions were already
|
|
// reachable from the target, meaning any SCC-wide properties deduced about it
|
|
// other than the set of functions within it will not have changed.
|
|
for (SCC *C : MergeRange) {
|
|
assert(C != &TargetSCC &&
|
|
"We merge *into* the target and shouldn't process it here!");
|
|
SCCIndices.erase(C);
|
|
TargetSCC.Nodes.append(C->Nodes.begin(), C->Nodes.end());
|
|
for (Node *N : C->Nodes)
|
|
G->SCCMap[N] = &TargetSCC;
|
|
C->clear();
|
|
DeletedSCCs.push_back(C);
|
|
}
|
|
|
|
// Erase the merged SCCs from the list and update the indices of the
|
|
// remaining SCCs.
|
|
int IndexOffset = MergeRange.end() - MergeRange.begin();
|
|
auto EraseEnd = SCCs.erase(MergeRange.begin(), MergeRange.end());
|
|
for (SCC *C : make_range(EraseEnd, SCCs.end()))
|
|
SCCIndices[C] -= IndexOffset;
|
|
|
|
// Now that the SCC structure is finalized, flip the kind to call.
|
|
SourceN->setEdgeKind(TargetN, Edge::Call);
|
|
|
|
// And we're done, but we did form a new cycle.
|
|
return true;
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::switchTrivialInternalEdgeToRef(Node &SourceN,
|
|
Node &TargetN) {
|
|
assert((*SourceN)[TargetN].isCall() && "Must start with a call edge!");
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() { verify(); });
|
|
#endif
|
|
|
|
assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC.");
|
|
assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC.");
|
|
assert(G->lookupSCC(SourceN) != G->lookupSCC(TargetN) &&
|
|
"Source and Target must be in separate SCCs for this to be trivial!");
|
|
|
|
// Set the edge kind.
|
|
SourceN->setEdgeKind(TargetN, Edge::Ref);
|
|
}
|
|
|
|
iterator_range<LazyCallGraph::RefSCC::iterator>
|
|
LazyCallGraph::RefSCC::switchInternalEdgeToRef(Node &SourceN, Node &TargetN) {
|
|
assert((*SourceN)[TargetN].isCall() && "Must start with a call edge!");
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() { verify(); });
|
|
#endif
|
|
|
|
assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC.");
|
|
assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC.");
|
|
|
|
SCC &TargetSCC = *G->lookupSCC(TargetN);
|
|
assert(G->lookupSCC(SourceN) == &TargetSCC && "Source and Target must be in "
|
|
"the same SCC to require the "
|
|
"full CG update.");
|
|
|
|
// Set the edge kind.
|
|
SourceN->setEdgeKind(TargetN, Edge::Ref);
|
|
|
|
// Otherwise we are removing a call edge from a single SCC. This may break
|
|
// the cycle. In order to compute the new set of SCCs, we need to do a small
|
|
// DFS over the nodes within the SCC to form any sub-cycles that remain as
|
|
// distinct SCCs and compute a postorder over the resulting SCCs.
|
|
//
|
|
// However, we specially handle the target node. The target node is known to
|
|
// reach all other nodes in the original SCC by definition. This means that
|
|
// we want the old SCC to be replaced with an SCC containing that node as it
|
|
// will be the root of whatever SCC DAG results from the DFS. Assumptions
|
|
// about an SCC such as the set of functions called will continue to hold,
|
|
// etc.
|
|
|
|
SCC &OldSCC = TargetSCC;
|
|
SmallVector<std::pair<Node *, EdgeSequence::call_iterator>, 16> DFSStack;
|
|
SmallVector<Node *, 16> PendingSCCStack;
|
|
SmallVector<SCC *, 4> NewSCCs;
|
|
|
|
// Prepare the nodes for a fresh DFS.
|
|
SmallVector<Node *, 16> Worklist;
|
|
Worklist.swap(OldSCC.Nodes);
|
|
for (Node *N : Worklist) {
|
|
N->DFSNumber = N->LowLink = 0;
|
|
G->SCCMap.erase(N);
|
|
}
|
|
|
|
// Force the target node to be in the old SCC. This also enables us to take
|
|
// a very significant short-cut in the standard Tarjan walk to re-form SCCs
|
|
// below: whenever we build an edge that reaches the target node, we know
|
|
// that the target node eventually connects back to all other nodes in our
|
|
// walk. As a consequence, we can detect and handle participants in that
|
|
// cycle without walking all the edges that form this connection, and instead
|
|
// by relying on the fundamental guarantee coming into this operation (all
|
|
// nodes are reachable from the target due to previously forming an SCC).
|
|
TargetN.DFSNumber = TargetN.LowLink = -1;
|
|
OldSCC.Nodes.push_back(&TargetN);
|
|
G->SCCMap[&TargetN] = &OldSCC;
|
|
|
|
// Scan down the stack and DFS across the call edges.
|
|
for (Node *RootN : Worklist) {
|
|
assert(DFSStack.empty() &&
|
|
"Cannot begin a new root with a non-empty DFS stack!");
|
|
assert(PendingSCCStack.empty() &&
|
|
"Cannot begin a new root with pending nodes for an SCC!");
|
|
|
|
// Skip any nodes we've already reached in the DFS.
|
|
if (RootN->DFSNumber != 0) {
|
|
assert(RootN->DFSNumber == -1 &&
|
|
"Shouldn't have any mid-DFS root nodes!");
|
|
continue;
|
|
}
|
|
|
|
RootN->DFSNumber = RootN->LowLink = 1;
|
|
int NextDFSNumber = 2;
|
|
|
|
DFSStack.emplace_back(RootN, (*RootN)->call_begin());
|
|
do {
|
|
auto [N, I] = DFSStack.pop_back_val();
|
|
auto E = (*N)->call_end();
|
|
while (I != E) {
|
|
Node &ChildN = I->getNode();
|
|
if (ChildN.DFSNumber == 0) {
|
|
// We haven't yet visited this child, so descend, pushing the current
|
|
// node onto the stack.
|
|
DFSStack.emplace_back(N, I);
|
|
|
|
assert(!G->SCCMap.count(&ChildN) &&
|
|
"Found a node with 0 DFS number but already in an SCC!");
|
|
ChildN.DFSNumber = ChildN.LowLink = NextDFSNumber++;
|
|
N = &ChildN;
|
|
I = (*N)->call_begin();
|
|
E = (*N)->call_end();
|
|
continue;
|
|
}
|
|
|
|
// Check for the child already being part of some component.
|
|
if (ChildN.DFSNumber == -1) {
|
|
if (G->lookupSCC(ChildN) == &OldSCC) {
|
|
// If the child is part of the old SCC, we know that it can reach
|
|
// every other node, so we have formed a cycle. Pull the entire DFS
|
|
// and pending stacks into it. See the comment above about setting
|
|
// up the old SCC for why we do this.
|
|
int OldSize = OldSCC.size();
|
|
OldSCC.Nodes.push_back(N);
|
|
OldSCC.Nodes.append(PendingSCCStack.begin(), PendingSCCStack.end());
|
|
PendingSCCStack.clear();
|
|
while (!DFSStack.empty())
|
|
OldSCC.Nodes.push_back(DFSStack.pop_back_val().first);
|
|
for (Node &N : drop_begin(OldSCC, OldSize)) {
|
|
N.DFSNumber = N.LowLink = -1;
|
|
G->SCCMap[&N] = &OldSCC;
|
|
}
|
|
N = nullptr;
|
|
break;
|
|
}
|
|
|
|
// If the child has already been added to some child component, it
|
|
// couldn't impact the low-link of this parent because it isn't
|
|
// connected, and thus its low-link isn't relevant so skip it.
|
|
++I;
|
|
continue;
|
|
}
|
|
|
|
// Track the lowest linked child as the lowest link for this node.
|
|
assert(ChildN.LowLink > 0 && "Must have a positive low-link number!");
|
|
if (ChildN.LowLink < N->LowLink)
|
|
N->LowLink = ChildN.LowLink;
|
|
|
|
// Move to the next edge.
|
|
++I;
|
|
}
|
|
if (!N)
|
|
// Cleared the DFS early, start another round.
|
|
break;
|
|
|
|
// We've finished processing N and its descendants, put it on our pending
|
|
// SCC stack to eventually get merged into an SCC of nodes.
|
|
PendingSCCStack.push_back(N);
|
|
|
|
// If this node is linked to some lower entry, continue walking up the
|
|
// stack.
|
|
if (N->LowLink != N->DFSNumber)
|
|
continue;
|
|
|
|
// Otherwise, we've completed an SCC. Append it to our post order list of
|
|
// SCCs.
|
|
int RootDFSNumber = N->DFSNumber;
|
|
// Find the range of the node stack by walking down until we pass the
|
|
// root DFS number.
|
|
auto SCCNodes = make_range(
|
|
PendingSCCStack.rbegin(),
|
|
find_if(reverse(PendingSCCStack), [RootDFSNumber](const Node *N) {
|
|
return N->DFSNumber < RootDFSNumber;
|
|
}));
|
|
|
|
// Form a new SCC out of these nodes and then clear them off our pending
|
|
// stack.
|
|
NewSCCs.push_back(G->createSCC(*this, SCCNodes));
|
|
for (Node &N : *NewSCCs.back()) {
|
|
N.DFSNumber = N.LowLink = -1;
|
|
G->SCCMap[&N] = NewSCCs.back();
|
|
}
|
|
PendingSCCStack.erase(SCCNodes.end().base(), PendingSCCStack.end());
|
|
} while (!DFSStack.empty());
|
|
}
|
|
|
|
// Insert the remaining SCCs before the old one. The old SCC can reach all
|
|
// other SCCs we form because it contains the target node of the removed edge
|
|
// of the old SCC. This means that we will have edges into all the new SCCs,
|
|
// which means the old one must come last for postorder.
|
|
int OldIdx = SCCIndices[&OldSCC];
|
|
SCCs.insert(SCCs.begin() + OldIdx, NewSCCs.begin(), NewSCCs.end());
|
|
|
|
// Update the mapping from SCC* to index to use the new SCC*s, and remove the
|
|
// old SCC from the mapping.
|
|
for (int Idx = OldIdx, Size = SCCs.size(); Idx < Size; ++Idx)
|
|
SCCIndices[SCCs[Idx]] = Idx;
|
|
|
|
return make_range(SCCs.begin() + OldIdx,
|
|
SCCs.begin() + OldIdx + NewSCCs.size());
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::switchOutgoingEdgeToCall(Node &SourceN,
|
|
Node &TargetN) {
|
|
assert(!(*SourceN)[TargetN].isCall() && "Must start with a ref edge!");
|
|
|
|
assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC.");
|
|
assert(G->lookupRefSCC(TargetN) != this &&
|
|
"Target must not be in this RefSCC.");
|
|
#ifdef EXPENSIVE_CHECKS
|
|
assert(G->lookupRefSCC(TargetN)->isDescendantOf(*this) &&
|
|
"Target must be a descendant of the Source.");
|
|
#endif
|
|
|
|
// Edges between RefSCCs are the same regardless of call or ref, so we can
|
|
// just flip the edge here.
|
|
SourceN->setEdgeKind(TargetN, Edge::Call);
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
#endif
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::switchOutgoingEdgeToRef(Node &SourceN,
|
|
Node &TargetN) {
|
|
assert((*SourceN)[TargetN].isCall() && "Must start with a call edge!");
|
|
|
|
assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC.");
|
|
assert(G->lookupRefSCC(TargetN) != this &&
|
|
"Target must not be in this RefSCC.");
|
|
#ifdef EXPENSIVE_CHECKS
|
|
assert(G->lookupRefSCC(TargetN)->isDescendantOf(*this) &&
|
|
"Target must be a descendant of the Source.");
|
|
#endif
|
|
|
|
// Edges between RefSCCs are the same regardless of call or ref, so we can
|
|
// just flip the edge here.
|
|
SourceN->setEdgeKind(TargetN, Edge::Ref);
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
#endif
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::insertInternalRefEdge(Node &SourceN,
|
|
Node &TargetN) {
|
|
assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC.");
|
|
assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC.");
|
|
|
|
SourceN->insertEdgeInternal(TargetN, Edge::Ref);
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
#endif
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::insertOutgoingEdge(Node &SourceN, Node &TargetN,
|
|
Edge::Kind EK) {
|
|
// First insert it into the caller.
|
|
SourceN->insertEdgeInternal(TargetN, EK);
|
|
|
|
assert(G->lookupRefSCC(SourceN) == this && "Source must be in this RefSCC.");
|
|
|
|
assert(G->lookupRefSCC(TargetN) != this &&
|
|
"Target must not be in this RefSCC.");
|
|
#ifdef EXPENSIVE_CHECKS
|
|
assert(G->lookupRefSCC(TargetN)->isDescendantOf(*this) &&
|
|
"Target must be a descendant of the Source.");
|
|
#endif
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
#endif
|
|
}
|
|
|
|
SmallVector<LazyCallGraph::RefSCC *, 1>
|
|
LazyCallGraph::RefSCC::insertIncomingRefEdge(Node &SourceN, Node &TargetN) {
|
|
assert(G->lookupRefSCC(TargetN) == this && "Target must be in this RefSCC.");
|
|
RefSCC &SourceC = *G->lookupRefSCC(SourceN);
|
|
assert(&SourceC != this && "Source must not be in this RefSCC.");
|
|
#ifdef EXPENSIVE_CHECKS
|
|
assert(SourceC.isDescendantOf(*this) &&
|
|
"Source must be a descendant of the Target.");
|
|
#endif
|
|
|
|
SmallVector<RefSCC *, 1> DeletedRefSCCs;
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() { verify(); });
|
|
#endif
|
|
|
|
int SourceIdx = G->RefSCCIndices[&SourceC];
|
|
int TargetIdx = G->RefSCCIndices[this];
|
|
assert(SourceIdx < TargetIdx &&
|
|
"Postorder list doesn't see edge as incoming!");
|
|
|
|
// Compute the RefSCCs which (transitively) reach the source. We do this by
|
|
// working backwards from the source using the parent set in each RefSCC,
|
|
// skipping any RefSCCs that don't fall in the postorder range. This has the
|
|
// advantage of walking the sparser parent edge (in high fan-out graphs) but
|
|
// more importantly this removes examining all forward edges in all RefSCCs
|
|
// within the postorder range which aren't in fact connected. Only connected
|
|
// RefSCCs (and their edges) are visited here.
|
|
auto ComputeSourceConnectedSet = [&](SmallPtrSetImpl<RefSCC *> &Set) {
|
|
Set.insert(&SourceC);
|
|
auto IsConnected = [&](RefSCC &RC) {
|
|
for (SCC &C : RC)
|
|
for (Node &N : C)
|
|
for (Edge &E : *N)
|
|
if (Set.count(G->lookupRefSCC(E.getNode())))
|
|
return true;
|
|
|
|
return false;
|
|
};
|
|
|
|
for (RefSCC *C : make_range(G->PostOrderRefSCCs.begin() + SourceIdx + 1,
|
|
G->PostOrderRefSCCs.begin() + TargetIdx + 1))
|
|
if (IsConnected(*C))
|
|
Set.insert(C);
|
|
};
|
|
|
|
// Use a normal worklist to find which SCCs the target connects to. We still
|
|
// bound the search based on the range in the postorder list we care about,
|
|
// but because this is forward connectivity we just "recurse" through the
|
|
// edges.
|
|
auto ComputeTargetConnectedSet = [&](SmallPtrSetImpl<RefSCC *> &Set) {
|
|
Set.insert(this);
|
|
SmallVector<RefSCC *, 4> Worklist;
|
|
Worklist.push_back(this);
|
|
do {
|
|
RefSCC &RC = *Worklist.pop_back_val();
|
|
for (SCC &C : RC)
|
|
for (Node &N : C)
|
|
for (Edge &E : *N) {
|
|
RefSCC &EdgeRC = *G->lookupRefSCC(E.getNode());
|
|
if (G->getRefSCCIndex(EdgeRC) <= SourceIdx)
|
|
// Not in the postorder sequence between source and target.
|
|
continue;
|
|
|
|
if (Set.insert(&EdgeRC).second)
|
|
Worklist.push_back(&EdgeRC);
|
|
}
|
|
} while (!Worklist.empty());
|
|
};
|
|
|
|
// Use a generic helper to update the postorder sequence of RefSCCs and return
|
|
// a range of any RefSCCs connected into a cycle by inserting this edge. This
|
|
// routine will also take care of updating the indices into the postorder
|
|
// sequence.
|
|
iterator_range<SmallVectorImpl<RefSCC *>::iterator> MergeRange =
|
|
updatePostorderSequenceForEdgeInsertion(
|
|
SourceC, *this, G->PostOrderRefSCCs, G->RefSCCIndices,
|
|
ComputeSourceConnectedSet, ComputeTargetConnectedSet);
|
|
|
|
// Build a set, so we can do fast tests for whether a RefSCC will end up as
|
|
// part of the merged RefSCC.
|
|
SmallPtrSet<RefSCC *, 16> MergeSet(MergeRange.begin(), MergeRange.end());
|
|
|
|
// This RefSCC will always be part of that set, so just insert it here.
|
|
MergeSet.insert(this);
|
|
|
|
// Now that we have identified all the SCCs which need to be merged into
|
|
// a connected set with the inserted edge, merge all of them into this SCC.
|
|
SmallVector<SCC *, 16> MergedSCCs;
|
|
int SCCIndex = 0;
|
|
for (RefSCC *RC : MergeRange) {
|
|
assert(RC != this && "We're merging into the target RefSCC, so it "
|
|
"shouldn't be in the range.");
|
|
|
|
// Walk the inner SCCs to update their up-pointer and walk all the edges to
|
|
// update any parent sets.
|
|
// FIXME: We should try to find a way to avoid this (rather expensive) edge
|
|
// walk by updating the parent sets in some other manner.
|
|
for (SCC &InnerC : *RC) {
|
|
InnerC.OuterRefSCC = this;
|
|
SCCIndices[&InnerC] = SCCIndex++;
|
|
for (Node &N : InnerC)
|
|
G->SCCMap[&N] = &InnerC;
|
|
}
|
|
|
|
// Now merge in the SCCs. We can actually move here so try to reuse storage
|
|
// the first time through.
|
|
if (MergedSCCs.empty())
|
|
MergedSCCs = std::move(RC->SCCs);
|
|
else
|
|
MergedSCCs.append(RC->SCCs.begin(), RC->SCCs.end());
|
|
RC->SCCs.clear();
|
|
DeletedRefSCCs.push_back(RC);
|
|
}
|
|
|
|
// Append our original SCCs to the merged list and move it into place.
|
|
for (SCC &InnerC : *this)
|
|
SCCIndices[&InnerC] = SCCIndex++;
|
|
MergedSCCs.append(SCCs.begin(), SCCs.end());
|
|
SCCs = std::move(MergedSCCs);
|
|
|
|
// Remove the merged away RefSCCs from the post order sequence.
|
|
for (RefSCC *RC : MergeRange)
|
|
G->RefSCCIndices.erase(RC);
|
|
int IndexOffset = MergeRange.end() - MergeRange.begin();
|
|
auto EraseEnd =
|
|
G->PostOrderRefSCCs.erase(MergeRange.begin(), MergeRange.end());
|
|
for (RefSCC *RC : make_range(EraseEnd, G->PostOrderRefSCCs.end()))
|
|
G->RefSCCIndices[RC] -= IndexOffset;
|
|
|
|
// At this point we have a merged RefSCC with a post-order SCCs list, just
|
|
// connect the nodes to form the new edge.
|
|
SourceN->insertEdgeInternal(TargetN, Edge::Ref);
|
|
|
|
// We return the list of SCCs which were merged so that callers can
|
|
// invalidate any data they have associated with those SCCs. Note that these
|
|
// SCCs are no longer in an interesting state (they are totally empty) but
|
|
// the pointers will remain stable for the life of the graph itself.
|
|
return DeletedRefSCCs;
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::removeOutgoingEdge(Node &SourceN, Node &TargetN) {
|
|
assert(G->lookupRefSCC(SourceN) == this &&
|
|
"The source must be a member of this RefSCC.");
|
|
assert(G->lookupRefSCC(TargetN) != this &&
|
|
"The target must not be a member of this RefSCC");
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() { verify(); });
|
|
#endif
|
|
|
|
// First remove it from the node.
|
|
bool Removed = SourceN->removeEdgeInternal(TargetN);
|
|
(void)Removed;
|
|
assert(Removed && "Target not in the edge set for this caller?");
|
|
}
|
|
|
|
SmallVector<LazyCallGraph::RefSCC *, 1>
|
|
LazyCallGraph::RefSCC::removeInternalRefEdges(
|
|
ArrayRef<std::pair<Node *, Node *>> Edges) {
|
|
// We return a list of the resulting *new* RefSCCs in post-order.
|
|
SmallVector<RefSCC *, 1> Result;
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Verify the RefSCC is valid to start with and that either we return an empty
|
|
// list of result RefSCCs and this RefSCC remains valid, or we return new
|
|
// RefSCCs and this RefSCC is dead.
|
|
verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() {
|
|
// If we didn't replace our RefSCC with new ones, check that this one
|
|
// remains valid.
|
|
if (G)
|
|
verify();
|
|
});
|
|
#endif
|
|
|
|
// First remove the actual edges.
|
|
for (auto [SourceN, TargetN] : Edges) {
|
|
assert(!(**SourceN)[*TargetN].isCall() &&
|
|
"Cannot remove a call edge, it must first be made a ref edge");
|
|
|
|
bool Removed = (*SourceN)->removeEdgeInternal(*TargetN);
|
|
(void)Removed;
|
|
assert(Removed && "Target not in the edge set for this caller?");
|
|
}
|
|
|
|
// Direct self references don't impact the ref graph at all.
|
|
// If all targets are in the same SCC as the source, because no call edges
|
|
// were removed there is no RefSCC structure change.
|
|
if (llvm::all_of(Edges, [&](std::pair<Node *, Node *> E) {
|
|
return E.first == E.second ||
|
|
G->lookupSCC(*E.first) == G->lookupSCC(*E.second);
|
|
}))
|
|
return Result;
|
|
|
|
// We build somewhat synthetic new RefSCCs by providing a postorder mapping
|
|
// for each inner SCC. We store these inside the low-link field of the nodes
|
|
// rather than associated with SCCs because this saves a round-trip through
|
|
// the node->SCC map and in the common case, SCCs are small. We will verify
|
|
// that we always give the same number to every node in the SCC such that
|
|
// these are equivalent.
|
|
int PostOrderNumber = 0;
|
|
|
|
// Reset all the other nodes to prepare for a DFS over them, and add them to
|
|
// our worklist.
|
|
SmallVector<Node *, 8> Worklist;
|
|
for (SCC *C : SCCs) {
|
|
for (Node &N : *C)
|
|
N.DFSNumber = N.LowLink = 0;
|
|
|
|
Worklist.append(C->Nodes.begin(), C->Nodes.end());
|
|
}
|
|
|
|
// Track the number of nodes in this RefSCC so that we can quickly recognize
|
|
// an important special case of the edge removal not breaking the cycle of
|
|
// this RefSCC.
|
|
const int NumRefSCCNodes = Worklist.size();
|
|
|
|
SmallVector<std::pair<Node *, EdgeSequence::iterator>, 4> DFSStack;
|
|
SmallVector<Node *, 4> PendingRefSCCStack;
|
|
do {
|
|
assert(DFSStack.empty() &&
|
|
"Cannot begin a new root with a non-empty DFS stack!");
|
|
assert(PendingRefSCCStack.empty() &&
|
|
"Cannot begin a new root with pending nodes for an SCC!");
|
|
|
|
Node *RootN = Worklist.pop_back_val();
|
|
// Skip any nodes we've already reached in the DFS.
|
|
if (RootN->DFSNumber != 0) {
|
|
assert(RootN->DFSNumber == -1 &&
|
|
"Shouldn't have any mid-DFS root nodes!");
|
|
continue;
|
|
}
|
|
|
|
RootN->DFSNumber = RootN->LowLink = 1;
|
|
int NextDFSNumber = 2;
|
|
|
|
DFSStack.emplace_back(RootN, (*RootN)->begin());
|
|
do {
|
|
auto [N, I] = DFSStack.pop_back_val();
|
|
auto E = (*N)->end();
|
|
|
|
assert(N->DFSNumber != 0 && "We should always assign a DFS number "
|
|
"before processing a node.");
|
|
|
|
while (I != E) {
|
|
Node &ChildN = I->getNode();
|
|
if (ChildN.DFSNumber == 0) {
|
|
// Mark that we should start at this child when next this node is the
|
|
// top of the stack. We don't start at the next child to ensure this
|
|
// child's lowlink is reflected.
|
|
DFSStack.emplace_back(N, I);
|
|
|
|
// Continue, resetting to the child node.
|
|
ChildN.LowLink = ChildN.DFSNumber = NextDFSNumber++;
|
|
N = &ChildN;
|
|
I = ChildN->begin();
|
|
E = ChildN->end();
|
|
continue;
|
|
}
|
|
if (ChildN.DFSNumber == -1) {
|
|
// If this child isn't currently in this RefSCC, no need to process
|
|
// it.
|
|
++I;
|
|
continue;
|
|
}
|
|
|
|
// Track the lowest link of the children, if any are still in the stack.
|
|
// Any child not on the stack will have a LowLink of -1.
|
|
assert(ChildN.LowLink != 0 &&
|
|
"Low-link must not be zero with a non-zero DFS number.");
|
|
if (ChildN.LowLink >= 0 && ChildN.LowLink < N->LowLink)
|
|
N->LowLink = ChildN.LowLink;
|
|
++I;
|
|
}
|
|
|
|
// We've finished processing N and its descendants, put it on our pending
|
|
// stack to eventually get merged into a RefSCC.
|
|
PendingRefSCCStack.push_back(N);
|
|
|
|
// If this node is linked to some lower entry, continue walking up the
|
|
// stack.
|
|
if (N->LowLink != N->DFSNumber) {
|
|
assert(!DFSStack.empty() &&
|
|
"We never found a viable root for a RefSCC to pop off!");
|
|
continue;
|
|
}
|
|
|
|
// Otherwise, form a new RefSCC from the top of the pending node stack.
|
|
int RefSCCNumber = PostOrderNumber++;
|
|
int RootDFSNumber = N->DFSNumber;
|
|
|
|
// Find the range of the node stack by walking down until we pass the
|
|
// root DFS number. Update the DFS numbers and low link numbers in the
|
|
// process to avoid re-walking this list where possible.
|
|
auto StackRI = find_if(reverse(PendingRefSCCStack), [&](Node *N) {
|
|
if (N->DFSNumber < RootDFSNumber)
|
|
// We've found the bottom.
|
|
return true;
|
|
|
|
// Update this node and keep scanning.
|
|
N->DFSNumber = -1;
|
|
// Save the post-order number in the lowlink field so that we can use
|
|
// it to map SCCs into new RefSCCs after we finish the DFS.
|
|
N->LowLink = RefSCCNumber;
|
|
return false;
|
|
});
|
|
auto RefSCCNodes = make_range(StackRI.base(), PendingRefSCCStack.end());
|
|
|
|
// If we find a cycle containing all nodes originally in this RefSCC then
|
|
// the removal hasn't changed the structure at all. This is an important
|
|
// special case, and we can directly exit the entire routine more
|
|
// efficiently as soon as we discover it.
|
|
if (llvm::size(RefSCCNodes) == NumRefSCCNodes) {
|
|
// Clear out the low link field as we won't need it.
|
|
for (Node *N : RefSCCNodes)
|
|
N->LowLink = -1;
|
|
// Return the empty result immediately.
|
|
return Result;
|
|
}
|
|
|
|
// We've already marked the nodes internally with the RefSCC number so
|
|
// just clear them off the stack and continue.
|
|
PendingRefSCCStack.erase(RefSCCNodes.begin(), PendingRefSCCStack.end());
|
|
} while (!DFSStack.empty());
|
|
|
|
assert(DFSStack.empty() && "Didn't flush the entire DFS stack!");
|
|
assert(PendingRefSCCStack.empty() && "Didn't flush all pending nodes!");
|
|
} while (!Worklist.empty());
|
|
|
|
assert(PostOrderNumber > 1 &&
|
|
"Should never finish the DFS when the existing RefSCC remains valid!");
|
|
|
|
// Otherwise we create a collection of new RefSCC nodes and build
|
|
// a radix-sort style map from postorder number to these new RefSCCs. We then
|
|
// append SCCs to each of these RefSCCs in the order they occurred in the
|
|
// original SCCs container.
|
|
for (int I = 0; I < PostOrderNumber; ++I)
|
|
Result.push_back(G->createRefSCC(*G));
|
|
|
|
// Insert the resulting postorder sequence into the global graph postorder
|
|
// sequence before the current RefSCC in that sequence, and then remove the
|
|
// current one.
|
|
//
|
|
// FIXME: It'd be nice to change the APIs so that we returned an iterator
|
|
// range over the global postorder sequence and generally use that sequence
|
|
// rather than building a separate result vector here.
|
|
int Idx = G->getRefSCCIndex(*this);
|
|
G->PostOrderRefSCCs.erase(G->PostOrderRefSCCs.begin() + Idx);
|
|
G->PostOrderRefSCCs.insert(G->PostOrderRefSCCs.begin() + Idx, Result.begin(),
|
|
Result.end());
|
|
for (int I : seq<int>(Idx, G->PostOrderRefSCCs.size()))
|
|
G->RefSCCIndices[G->PostOrderRefSCCs[I]] = I;
|
|
|
|
for (SCC *C : SCCs) {
|
|
// We store the SCC number in the node's low-link field above.
|
|
int SCCNumber = C->begin()->LowLink;
|
|
// Clear out all the SCC's node's low-link fields now that we're done
|
|
// using them as side-storage.
|
|
for (Node &N : *C) {
|
|
assert(N.LowLink == SCCNumber &&
|
|
"Cannot have different numbers for nodes in the same SCC!");
|
|
N.LowLink = -1;
|
|
}
|
|
|
|
RefSCC &RC = *Result[SCCNumber];
|
|
int SCCIndex = RC.SCCs.size();
|
|
RC.SCCs.push_back(C);
|
|
RC.SCCIndices[C] = SCCIndex;
|
|
C->OuterRefSCC = &RC;
|
|
}
|
|
|
|
// Now that we've moved things into the new RefSCCs, clear out our current
|
|
// one.
|
|
G = nullptr;
|
|
SCCs.clear();
|
|
SCCIndices.clear();
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
// Verify the new RefSCCs we've built.
|
|
for (RefSCC *RC : Result)
|
|
RC->verify();
|
|
#endif
|
|
|
|
// Return the new list of SCCs.
|
|
return Result;
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::insertTrivialCallEdge(Node &SourceN,
|
|
Node &TargetN) {
|
|
#ifdef EXPENSIVE_CHECKS
|
|
auto ExitVerifier = make_scope_exit([this] { verify(); });
|
|
|
|
// Check that we aren't breaking some invariants of the SCC graph. Note that
|
|
// this is quadratic in the number of edges in the call graph!
|
|
SCC &SourceC = *G->lookupSCC(SourceN);
|
|
SCC &TargetC = *G->lookupSCC(TargetN);
|
|
if (&SourceC != &TargetC)
|
|
assert(SourceC.isAncestorOf(TargetC) &&
|
|
"Call edge is not trivial in the SCC graph!");
|
|
#endif
|
|
|
|
// First insert it into the source or find the existing edge.
|
|
auto [Iterator, Inserted] =
|
|
SourceN->EdgeIndexMap.try_emplace(&TargetN, SourceN->Edges.size());
|
|
if (!Inserted) {
|
|
// Already an edge, just update it.
|
|
Edge &E = SourceN->Edges[Iterator->second];
|
|
if (E.isCall())
|
|
return; // Nothing to do!
|
|
E.setKind(Edge::Call);
|
|
} else {
|
|
// Create the new edge.
|
|
SourceN->Edges.emplace_back(TargetN, Edge::Call);
|
|
}
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::insertTrivialRefEdge(Node &SourceN, Node &TargetN) {
|
|
#ifdef EXPENSIVE_CHECKS
|
|
auto ExitVerifier = make_scope_exit([this] { verify(); });
|
|
|
|
// Check that we aren't breaking some invariants of the RefSCC graph.
|
|
RefSCC &SourceRC = *G->lookupRefSCC(SourceN);
|
|
RefSCC &TargetRC = *G->lookupRefSCC(TargetN);
|
|
if (&SourceRC != &TargetRC)
|
|
assert(SourceRC.isAncestorOf(TargetRC) &&
|
|
"Ref edge is not trivial in the RefSCC graph!");
|
|
#endif
|
|
|
|
// First insert it into the source or find the existing edge.
|
|
auto [Iterator, Inserted] =
|
|
SourceN->EdgeIndexMap.try_emplace(&TargetN, SourceN->Edges.size());
|
|
(void)Iterator;
|
|
if (!Inserted)
|
|
// Already an edge, we're done.
|
|
return;
|
|
|
|
// Create the new edge.
|
|
SourceN->Edges.emplace_back(TargetN, Edge::Ref);
|
|
}
|
|
|
|
void LazyCallGraph::RefSCC::replaceNodeFunction(Node &N, Function &NewF) {
|
|
Function &OldF = N.getFunction();
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
auto ExitVerifier = make_scope_exit([this] { verify(); });
|
|
|
|
assert(G->lookupRefSCC(N) == this &&
|
|
"Cannot replace the function of a node outside this RefSCC.");
|
|
|
|
assert(G->NodeMap.find(&NewF) == G->NodeMap.end() &&
|
|
"Must not have already walked the new function!'");
|
|
|
|
// It is important that this replacement not introduce graph changes so we
|
|
// insist that the caller has already removed every use of the original
|
|
// function and that all uses of the new function correspond to existing
|
|
// edges in the graph. The common and expected way to use this is when
|
|
// replacing the function itself in the IR without changing the call graph
|
|
// shape and just updating the analysis based on that.
|
|
assert(&OldF != &NewF && "Cannot replace a function with itself!");
|
|
assert(OldF.use_empty() &&
|
|
"Must have moved all uses from the old function to the new!");
|
|
#endif
|
|
|
|
N.replaceFunction(NewF);
|
|
|
|
// Update various call graph maps.
|
|
G->NodeMap.erase(&OldF);
|
|
G->NodeMap[&NewF] = &N;
|
|
|
|
// Update lib functions.
|
|
if (G->isLibFunction(OldF)) {
|
|
G->LibFunctions.remove(&OldF);
|
|
G->LibFunctions.insert(&NewF);
|
|
}
|
|
}
|
|
|
|
void LazyCallGraph::insertEdge(Node &SourceN, Node &TargetN, Edge::Kind EK) {
|
|
assert(SCCMap.empty() &&
|
|
"This method cannot be called after SCCs have been formed!");
|
|
|
|
return SourceN->insertEdgeInternal(TargetN, EK);
|
|
}
|
|
|
|
void LazyCallGraph::removeEdge(Node &SourceN, Node &TargetN) {
|
|
assert(SCCMap.empty() &&
|
|
"This method cannot be called after SCCs have been formed!");
|
|
|
|
bool Removed = SourceN->removeEdgeInternal(TargetN);
|
|
(void)Removed;
|
|
assert(Removed && "Target not in the edge set for this caller?");
|
|
}
|
|
|
|
void LazyCallGraph::markDeadFunction(Function &F) {
|
|
// FIXME: This is unnecessarily restrictive. We should be able to remove
|
|
// functions which recursively call themselves.
|
|
assert(F.hasZeroLiveUses() &&
|
|
"This routine should only be called on trivially dead functions!");
|
|
|
|
// We shouldn't remove library functions as they are never really dead while
|
|
// the call graph is in use -- every function definition refers to them.
|
|
assert(!isLibFunction(F) &&
|
|
"Must not remove lib functions from the call graph!");
|
|
|
|
auto NI = NodeMap.find(&F);
|
|
assert(NI != NodeMap.end() && "Removed function should be known!");
|
|
|
|
Node &N = *NI->second;
|
|
|
|
// Remove all call edges out of dead function.
|
|
for (Edge E : *N) {
|
|
if (E.isCall())
|
|
N->setEdgeKind(E.getNode(), Edge::Ref);
|
|
}
|
|
}
|
|
|
|
void LazyCallGraph::removeDeadFunctions(ArrayRef<Function *> DeadFs) {
|
|
if (DeadFs.empty())
|
|
return;
|
|
|
|
// Group dead functions by the RefSCC they're in.
|
|
DenseMap<RefSCC *, SmallVector<Node *, 1>> RCs;
|
|
for (Function *DeadF : DeadFs) {
|
|
Node *N = lookup(*DeadF);
|
|
#ifndef NDEBUG
|
|
for (Edge &E : **N) {
|
|
assert(!E.isCall() &&
|
|
"dead function shouldn't have any outgoing call edges");
|
|
}
|
|
#endif
|
|
RefSCC *RC = lookupRefSCC(*N);
|
|
RCs[RC].push_back(N);
|
|
}
|
|
// Remove outgoing edges from all dead functions. Dead functions should
|
|
// already have had their call edges removed in markDeadFunction(), so we only
|
|
// need to worry about spurious ref edges.
|
|
for (auto [RC, DeadNs] : RCs) {
|
|
SmallVector<std::pair<Node *, Node *>> InternalEdgesToRemove;
|
|
for (Node *DeadN : DeadNs) {
|
|
for (Edge &E : **DeadN) {
|
|
if (lookupRefSCC(E.getNode()) == RC)
|
|
InternalEdgesToRemove.push_back({DeadN, &E.getNode()});
|
|
else
|
|
RC->removeOutgoingEdge(*DeadN, E.getNode());
|
|
}
|
|
}
|
|
// We ignore the returned RefSCCs since at this point we're done with CGSCC
|
|
// iteration and don't need to add it to any worklists.
|
|
(void)RC->removeInternalRefEdges(InternalEdgesToRemove);
|
|
for (Node *DeadN : DeadNs) {
|
|
RefSCC *DeadRC = lookupRefSCC(*DeadN);
|
|
assert(DeadRC->size() == 1);
|
|
assert(DeadRC->begin()->size() == 1);
|
|
DeadRC->clear();
|
|
DeadRC->G = nullptr;
|
|
}
|
|
}
|
|
// Clean up data structures.
|
|
for (Function *DeadF : DeadFs) {
|
|
Node &N = *lookup(*DeadF);
|
|
|
|
EntryEdges.removeEdgeInternal(N);
|
|
SCCMap.erase(SCCMap.find(&N));
|
|
NodeMap.erase(NodeMap.find(DeadF));
|
|
|
|
N.clear();
|
|
N.G = nullptr;
|
|
N.F = nullptr;
|
|
}
|
|
}
|
|
|
|
// Gets the Edge::Kind from one function to another by looking at the function's
|
|
// instructions. Asserts if there is no edge.
|
|
// Useful for determining what type of edge should exist between functions when
|
|
// the edge hasn't been created yet.
|
|
static LazyCallGraph::Edge::Kind getEdgeKind(Function &OriginalFunction,
|
|
Function &NewFunction) {
|
|
// In release builds, assume that if there are no direct calls to the new
|
|
// function, then there is a ref edge. In debug builds, keep track of
|
|
// references to assert that there is actually a ref edge if there is no call
|
|
// edge.
|
|
#ifndef NDEBUG
|
|
SmallVector<Constant *, 16> Worklist;
|
|
SmallPtrSet<Constant *, 16> Visited;
|
|
#endif
|
|
|
|
for (Instruction &I : instructions(OriginalFunction)) {
|
|
if (auto *CB = dyn_cast<CallBase>(&I)) {
|
|
if (Function *Callee = CB->getCalledFunction()) {
|
|
if (Callee == &NewFunction)
|
|
return LazyCallGraph::Edge::Kind::Call;
|
|
}
|
|
}
|
|
#ifndef NDEBUG
|
|
for (Value *Op : I.operand_values()) {
|
|
if (Constant *C = dyn_cast<Constant>(Op)) {
|
|
if (Visited.insert(C).second)
|
|
Worklist.push_back(C);
|
|
}
|
|
}
|
|
#endif
|
|
}
|
|
|
|
#ifndef NDEBUG
|
|
bool FoundNewFunction = false;
|
|
LazyCallGraph::visitReferences(Worklist, Visited, [&](Function &F) {
|
|
if (&F == &NewFunction)
|
|
FoundNewFunction = true;
|
|
});
|
|
assert(FoundNewFunction && "No edge from original function to new function");
|
|
#endif
|
|
|
|
return LazyCallGraph::Edge::Kind::Ref;
|
|
}
|
|
|
|
void LazyCallGraph::addSplitFunction(Function &OriginalFunction,
|
|
Function &NewFunction) {
|
|
assert(lookup(OriginalFunction) &&
|
|
"Original function's node should already exist");
|
|
Node &OriginalN = get(OriginalFunction);
|
|
SCC *OriginalC = lookupSCC(OriginalN);
|
|
RefSCC *OriginalRC = lookupRefSCC(OriginalN);
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
OriginalRC->verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() { OriginalRC->verify(); });
|
|
#endif
|
|
|
|
assert(!lookup(NewFunction) &&
|
|
"New function's node should not already exist");
|
|
Node &NewN = initNode(NewFunction);
|
|
|
|
Edge::Kind EK = getEdgeKind(OriginalFunction, NewFunction);
|
|
|
|
SCC *NewC = nullptr;
|
|
for (Edge &E : *NewN) {
|
|
Node &EN = E.getNode();
|
|
if (EK == Edge::Kind::Call && E.isCall() && lookupSCC(EN) == OriginalC) {
|
|
// If the edge to the new function is a call edge and there is a call edge
|
|
// from the new function to any function in the original function's SCC,
|
|
// it is in the same SCC (and RefSCC) as the original function.
|
|
NewC = OriginalC;
|
|
NewC->Nodes.push_back(&NewN);
|
|
break;
|
|
}
|
|
}
|
|
|
|
if (!NewC) {
|
|
for (Edge &E : *NewN) {
|
|
Node &EN = E.getNode();
|
|
if (lookupRefSCC(EN) == OriginalRC) {
|
|
// If there is any edge from the new function to any function in the
|
|
// original function's RefSCC, it is in the same RefSCC as the original
|
|
// function but a new SCC.
|
|
RefSCC *NewRC = OriginalRC;
|
|
NewC = createSCC(*NewRC, SmallVector<Node *, 1>({&NewN}));
|
|
|
|
// The new function's SCC is not the same as the original function's
|
|
// SCC, since that case was handled earlier. If the edge from the
|
|
// original function to the new function was a call edge, then we need
|
|
// to insert the newly created function's SCC before the original
|
|
// function's SCC. Otherwise, either the new SCC comes after the
|
|
// original function's SCC, or it doesn't matter, and in both cases we
|
|
// can add it to the very end.
|
|
int InsertIndex = EK == Edge::Kind::Call ? NewRC->SCCIndices[OriginalC]
|
|
: NewRC->SCCIndices.size();
|
|
NewRC->SCCs.insert(NewRC->SCCs.begin() + InsertIndex, NewC);
|
|
for (int I = InsertIndex, Size = NewRC->SCCs.size(); I < Size; ++I)
|
|
NewRC->SCCIndices[NewRC->SCCs[I]] = I;
|
|
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
if (!NewC) {
|
|
// We didn't find any edges back to the original function's RefSCC, so the
|
|
// new function belongs in a new RefSCC. The new RefSCC goes before the
|
|
// original function's RefSCC.
|
|
RefSCC *NewRC = createRefSCC(*this);
|
|
NewC = createSCC(*NewRC, SmallVector<Node *, 1>({&NewN}));
|
|
NewRC->SCCIndices[NewC] = 0;
|
|
NewRC->SCCs.push_back(NewC);
|
|
auto OriginalRCIndex = RefSCCIndices.find(OriginalRC)->second;
|
|
PostOrderRefSCCs.insert(PostOrderRefSCCs.begin() + OriginalRCIndex, NewRC);
|
|
for (int I = OriginalRCIndex, Size = PostOrderRefSCCs.size(); I < Size; ++I)
|
|
RefSCCIndices[PostOrderRefSCCs[I]] = I;
|
|
}
|
|
|
|
SCCMap[&NewN] = NewC;
|
|
|
|
OriginalN->insertEdgeInternal(NewN, EK);
|
|
}
|
|
|
|
void LazyCallGraph::addSplitRefRecursiveFunctions(
|
|
Function &OriginalFunction, ArrayRef<Function *> NewFunctions) {
|
|
assert(!NewFunctions.empty() && "Can't add zero functions");
|
|
assert(lookup(OriginalFunction) &&
|
|
"Original function's node should already exist");
|
|
Node &OriginalN = get(OriginalFunction);
|
|
RefSCC *OriginalRC = lookupRefSCC(OriginalN);
|
|
|
|
#ifdef EXPENSIVE_CHECKS
|
|
OriginalRC->verify();
|
|
auto VerifyOnExit = make_scope_exit([&]() {
|
|
OriginalRC->verify();
|
|
for (Function *NewFunction : NewFunctions)
|
|
lookupRefSCC(get(*NewFunction))->verify();
|
|
});
|
|
#endif
|
|
|
|
bool ExistsRefToOriginalRefSCC = false;
|
|
|
|
for (Function *NewFunction : NewFunctions) {
|
|
Node &NewN = initNode(*NewFunction);
|
|
|
|
// Make the original function reference each new function
|
|
OriginalN->insertEdgeInternal(NewN, Edge::Kind::Ref);
|
|
|
|
// Check if there is any edge from any new function back to any function in
|
|
// the original function's RefSCC.
|
|
for (Edge &E : *NewN) {
|
|
if (lookupRefSCC(E.getNode()) == OriginalRC) {
|
|
ExistsRefToOriginalRefSCC = true;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
|
|
RefSCC *NewRC;
|
|
if (ExistsRefToOriginalRefSCC) {
|
|
// If there is any edge from any new function to any function in the
|
|
// original function's RefSCC, all new functions will be in the same RefSCC
|
|
// as the original function.
|
|
NewRC = OriginalRC;
|
|
} else {
|
|
// Otherwise the new functions are in their own RefSCC.
|
|
NewRC = createRefSCC(*this);
|
|
// The new RefSCC goes before the original function's RefSCC in postorder
|
|
// since there are only edges from the original function's RefSCC to the new
|
|
// RefSCC.
|
|
auto OriginalRCIndex = RefSCCIndices.find(OriginalRC)->second;
|
|
PostOrderRefSCCs.insert(PostOrderRefSCCs.begin() + OriginalRCIndex, NewRC);
|
|
for (int I = OriginalRCIndex, Size = PostOrderRefSCCs.size(); I < Size; ++I)
|
|
RefSCCIndices[PostOrderRefSCCs[I]] = I;
|
|
}
|
|
|
|
for (Function *NewFunction : NewFunctions) {
|
|
Node &NewN = get(*NewFunction);
|
|
// Each new function is in its own new SCC. The original function can only
|
|
// have a ref edge to new functions, and no other existing functions can
|
|
// have references to new functions. Each new function only has a ref edge
|
|
// to the other new functions.
|
|
SCC *NewC = createSCC(*NewRC, SmallVector<Node *, 1>({&NewN}));
|
|
// The new SCCs are either sibling SCCs or parent SCCs to all other existing
|
|
// SCCs in the RefSCC. Either way, they can go at the back of the postorder
|
|
// SCC list.
|
|
auto Index = NewRC->SCCIndices.size();
|
|
NewRC->SCCIndices[NewC] = Index;
|
|
NewRC->SCCs.push_back(NewC);
|
|
SCCMap[&NewN] = NewC;
|
|
}
|
|
|
|
#ifndef NDEBUG
|
|
for (Function *F1 : NewFunctions) {
|
|
assert(getEdgeKind(OriginalFunction, *F1) == Edge::Kind::Ref &&
|
|
"Expected ref edges from original function to every new function");
|
|
Node &N1 = get(*F1);
|
|
for (Function *F2 : NewFunctions) {
|
|
if (F1 == F2)
|
|
continue;
|
|
Node &N2 = get(*F2);
|
|
assert(!N1->lookup(N2) ||
|
|
(!N1->lookup(N2)->isCall() &&
|
|
"Edges between new functions must be ref edges"));
|
|
}
|
|
}
|
|
#endif
|
|
}
|
|
|
|
LazyCallGraph::Node &LazyCallGraph::insertInto(Function &F, Node *&MappedN) {
|
|
return *new (MappedN = BPA.Allocate()) Node(*this, F);
|
|
}
|
|
|
|
void LazyCallGraph::updateGraphPtrs() {
|
|
// Walk the node map to update their graph pointers. While this iterates in
|
|
// an unstable order, the order has no effect, so it remains correct.
|
|
for (auto &FunctionNodePair : NodeMap)
|
|
FunctionNodePair.second->G = this;
|
|
|
|
for (auto *RC : PostOrderRefSCCs)
|
|
RC->G = this;
|
|
}
|
|
|
|
LazyCallGraph::Node &LazyCallGraph::initNode(Function &F) {
|
|
Node &N = get(F);
|
|
N.DFSNumber = N.LowLink = -1;
|
|
N.populate();
|
|
NodeMap[&F] = &N;
|
|
return N;
|
|
}
|
|
|
|
template <typename RootsT, typename GetBeginT, typename GetEndT,
|
|
typename GetNodeT, typename FormSCCCallbackT>
|
|
void LazyCallGraph::buildGenericSCCs(RootsT &&Roots, GetBeginT &&GetBegin,
|
|
GetEndT &&GetEnd, GetNodeT &&GetNode,
|
|
FormSCCCallbackT &&FormSCC) {
|
|
using EdgeItT = decltype(GetBegin(std::declval<Node &>()));
|
|
|
|
SmallVector<std::pair<Node *, EdgeItT>, 16> DFSStack;
|
|
SmallVector<Node *, 16> PendingSCCStack;
|
|
|
|
// Scan down the stack and DFS across the call edges.
|
|
for (Node *RootN : Roots) {
|
|
assert(DFSStack.empty() &&
|
|
"Cannot begin a new root with a non-empty DFS stack!");
|
|
assert(PendingSCCStack.empty() &&
|
|
"Cannot begin a new root with pending nodes for an SCC!");
|
|
|
|
// Skip any nodes we've already reached in the DFS.
|
|
if (RootN->DFSNumber != 0) {
|
|
assert(RootN->DFSNumber == -1 &&
|
|
"Shouldn't have any mid-DFS root nodes!");
|
|
continue;
|
|
}
|
|
|
|
RootN->DFSNumber = RootN->LowLink = 1;
|
|
int NextDFSNumber = 2;
|
|
|
|
DFSStack.emplace_back(RootN, GetBegin(*RootN));
|
|
do {
|
|
auto [N, I] = DFSStack.pop_back_val();
|
|
auto E = GetEnd(*N);
|
|
while (I != E) {
|
|
Node &ChildN = GetNode(I);
|
|
if (ChildN.DFSNumber == 0) {
|
|
// We haven't yet visited this child, so descend, pushing the current
|
|
// node onto the stack.
|
|
DFSStack.emplace_back(N, I);
|
|
|
|
ChildN.DFSNumber = ChildN.LowLink = NextDFSNumber++;
|
|
N = &ChildN;
|
|
I = GetBegin(*N);
|
|
E = GetEnd(*N);
|
|
continue;
|
|
}
|
|
|
|
// If the child has already been added to some child component, it
|
|
// couldn't impact the low-link of this parent because it isn't
|
|
// connected, and thus its low-link isn't relevant so skip it.
|
|
if (ChildN.DFSNumber == -1) {
|
|
++I;
|
|
continue;
|
|
}
|
|
|
|
// Track the lowest linked child as the lowest link for this node.
|
|
assert(ChildN.LowLink > 0 && "Must have a positive low-link number!");
|
|
if (ChildN.LowLink < N->LowLink)
|
|
N->LowLink = ChildN.LowLink;
|
|
|
|
// Move to the next edge.
|
|
++I;
|
|
}
|
|
|
|
// We've finished processing N and its descendants, put it on our pending
|
|
// SCC stack to eventually get merged into an SCC of nodes.
|
|
PendingSCCStack.push_back(N);
|
|
|
|
// If this node is linked to some lower entry, continue walking up the
|
|
// stack.
|
|
if (N->LowLink != N->DFSNumber)
|
|
continue;
|
|
|
|
// Otherwise, we've completed an SCC. Append it to our post order list of
|
|
// SCCs.
|
|
int RootDFSNumber = N->DFSNumber;
|
|
// Find the range of the node stack by walking down until we pass the
|
|
// root DFS number.
|
|
auto SCCNodes = make_range(
|
|
PendingSCCStack.rbegin(),
|
|
find_if(reverse(PendingSCCStack), [RootDFSNumber](const Node *N) {
|
|
return N->DFSNumber < RootDFSNumber;
|
|
}));
|
|
// Form a new SCC out of these nodes and then clear them off our pending
|
|
// stack.
|
|
FormSCC(SCCNodes);
|
|
PendingSCCStack.erase(SCCNodes.end().base(), PendingSCCStack.end());
|
|
} while (!DFSStack.empty());
|
|
}
|
|
}
|
|
|
|
/// Build the internal SCCs for a RefSCC from a sequence of nodes.
|
|
///
|
|
/// Appends the SCCs to the provided vector and updates the map with their
|
|
/// indices. Both the vector and map must be empty when passed into this
|
|
/// routine.
|
|
void LazyCallGraph::buildSCCs(RefSCC &RC, node_stack_range Nodes) {
|
|
assert(RC.SCCs.empty() && "Already built SCCs!");
|
|
assert(RC.SCCIndices.empty() && "Already mapped SCC indices!");
|
|
|
|
for (Node *N : Nodes) {
|
|
assert(N->LowLink >= (*Nodes.begin())->LowLink &&
|
|
"We cannot have a low link in an SCC lower than its root on the "
|
|
"stack!");
|
|
|
|
// This node will go into the next RefSCC, clear out its DFS and low link
|
|
// as we scan.
|
|
N->DFSNumber = N->LowLink = 0;
|
|
}
|
|
|
|
// Each RefSCC contains a DAG of the call SCCs. To build these, we do
|
|
// a direct walk of the call edges using Tarjan's algorithm. We reuse the
|
|
// internal storage as we won't need it for the outer graph's DFS any longer.
|
|
buildGenericSCCs(
|
|
Nodes, [](Node &N) { return N->call_begin(); },
|
|
[](Node &N) { return N->call_end(); },
|
|
[](EdgeSequence::call_iterator I) -> Node & { return I->getNode(); },
|
|
[this, &RC](node_stack_range Nodes) {
|
|
RC.SCCs.push_back(createSCC(RC, Nodes));
|
|
for (Node &N : *RC.SCCs.back()) {
|
|
N.DFSNumber = N.LowLink = -1;
|
|
SCCMap[&N] = RC.SCCs.back();
|
|
}
|
|
});
|
|
|
|
// Wire up the SCC indices.
|
|
for (int I = 0, Size = RC.SCCs.size(); I < Size; ++I)
|
|
RC.SCCIndices[RC.SCCs[I]] = I;
|
|
}
|
|
|
|
void LazyCallGraph::buildRefSCCs() {
|
|
if (EntryEdges.empty() || !PostOrderRefSCCs.empty())
|
|
// RefSCCs are either non-existent or already built!
|
|
return;
|
|
|
|
assert(RefSCCIndices.empty() && "Already mapped RefSCC indices!");
|
|
|
|
SmallVector<Node *, 16> Roots;
|
|
for (Edge &E : *this)
|
|
Roots.push_back(&E.getNode());
|
|
|
|
// The roots will be iterated in order.
|
|
buildGenericSCCs(
|
|
Roots,
|
|
[](Node &N) {
|
|
// We need to populate each node as we begin to walk its edges.
|
|
N.populate();
|
|
return N->begin();
|
|
},
|
|
[](Node &N) { return N->end(); },
|
|
[](EdgeSequence::iterator I) -> Node & { return I->getNode(); },
|
|
[this](node_stack_range Nodes) {
|
|
RefSCC *NewRC = createRefSCC(*this);
|
|
buildSCCs(*NewRC, Nodes);
|
|
|
|
// Push the new node into the postorder list and remember its position
|
|
// in the index map.
|
|
bool Inserted =
|
|
RefSCCIndices.try_emplace(NewRC, PostOrderRefSCCs.size()).second;
|
|
(void)Inserted;
|
|
assert(Inserted && "Cannot already have this RefSCC in the index map!");
|
|
PostOrderRefSCCs.push_back(NewRC);
|
|
#ifdef EXPENSIVE_CHECKS
|
|
NewRC->verify();
|
|
#endif
|
|
});
|
|
}
|
|
|
|
void LazyCallGraph::visitReferences(SmallVectorImpl<Constant *> &Worklist,
|
|
SmallPtrSetImpl<Constant *> &Visited,
|
|
function_ref<void(Function &)> Callback) {
|
|
while (!Worklist.empty()) {
|
|
Constant *C = Worklist.pop_back_val();
|
|
|
|
if (Function *F = dyn_cast<Function>(C)) {
|
|
if (!F->isDeclaration())
|
|
Callback(*F);
|
|
continue;
|
|
}
|
|
|
|
// blockaddresses are weird and don't participate in the call graph anyway,
|
|
// skip them.
|
|
if (isa<BlockAddress>(C))
|
|
continue;
|
|
|
|
for (Value *Op : C->operand_values())
|
|
if (Visited.insert(cast<Constant>(Op)).second)
|
|
Worklist.push_back(cast<Constant>(Op));
|
|
}
|
|
}
|
|
|
|
AnalysisKey LazyCallGraphAnalysis::Key;
|
|
|
|
LazyCallGraphPrinterPass::LazyCallGraphPrinterPass(raw_ostream &OS) : OS(OS) {}
|
|
|
|
static void printNode(raw_ostream &OS, LazyCallGraph::Node &N) {
|
|
OS << " Edges in function: " << N.getFunction().getName() << "\n";
|
|
for (LazyCallGraph::Edge &E : N.populate())
|
|
OS << " " << (E.isCall() ? "call" : "ref ") << " -> "
|
|
<< E.getFunction().getName() << "\n";
|
|
|
|
OS << "\n";
|
|
}
|
|
|
|
static void printSCC(raw_ostream &OS, LazyCallGraph::SCC &C) {
|
|
OS << " SCC with " << C.size() << " functions:\n";
|
|
|
|
for (LazyCallGraph::Node &N : C)
|
|
OS << " " << N.getFunction().getName() << "\n";
|
|
}
|
|
|
|
static void printRefSCC(raw_ostream &OS, LazyCallGraph::RefSCC &C) {
|
|
OS << " RefSCC with " << C.size() << " call SCCs:\n";
|
|
|
|
for (LazyCallGraph::SCC &InnerC : C)
|
|
printSCC(OS, InnerC);
|
|
|
|
OS << "\n";
|
|
}
|
|
|
|
PreservedAnalyses LazyCallGraphPrinterPass::run(Module &M,
|
|
ModuleAnalysisManager &AM) {
|
|
LazyCallGraph &G = AM.getResult<LazyCallGraphAnalysis>(M);
|
|
|
|
OS << "Printing the call graph for module: " << M.getModuleIdentifier()
|
|
<< "\n\n";
|
|
|
|
for (Function &F : M)
|
|
printNode(OS, G.get(F));
|
|
|
|
G.buildRefSCCs();
|
|
for (LazyCallGraph::RefSCC &C : G.postorder_ref_sccs())
|
|
printRefSCC(OS, C);
|
|
|
|
return PreservedAnalyses::all();
|
|
}
|
|
|
|
LazyCallGraphDOTPrinterPass::LazyCallGraphDOTPrinterPass(raw_ostream &OS)
|
|
: OS(OS) {}
|
|
|
|
static void printNodeDOT(raw_ostream &OS, LazyCallGraph::Node &N) {
|
|
std::string Name =
|
|
"\"" + DOT::EscapeString(std::string(N.getFunction().getName())) + "\"";
|
|
|
|
for (LazyCallGraph::Edge &E : N.populate()) {
|
|
OS << " " << Name << " -> \""
|
|
<< DOT::EscapeString(std::string(E.getFunction().getName())) << "\"";
|
|
if (!E.isCall()) // It is a ref edge.
|
|
OS << " [style=dashed,label=\"ref\"]";
|
|
OS << ";\n";
|
|
}
|
|
|
|
OS << "\n";
|
|
}
|
|
|
|
PreservedAnalyses LazyCallGraphDOTPrinterPass::run(Module &M,
|
|
ModuleAnalysisManager &AM) {
|
|
LazyCallGraph &G = AM.getResult<LazyCallGraphAnalysis>(M);
|
|
|
|
OS << "digraph \"" << DOT::EscapeString(M.getModuleIdentifier()) << "\" {\n";
|
|
|
|
for (Function &F : M)
|
|
printNodeDOT(OS, G.get(F));
|
|
|
|
OS << "}\n";
|
|
|
|
return PreservedAnalyses::all();
|
|
}
|